| Names | |
|---|---|
| Preferred IUPAC name
3-Methylheptane1 | |
| Identifiers | |
3D model (JSmol)
|
|
| 1730777 | |
| ChemSpider |
|
| ECHA InfoCard | 100.008.783 |
| EC Number |
|
PubChem CID
|
|
| UNII | |
| UN number | 1262 |
CompTox Dashboard (EPA)
|
|
| |
| Properties | |
| C8H18 | |
| Molar mass | 114.232 g·mol−1 |
| Appearance | Colourless liquid |
| Odor | Odourless |
| Density | 705 mg mL−1 |
| Melting point | −122 to −120 °C; −188 to −184 °F; 151 to 153 K |
| Boiling point | 118 to 120 °C; 244 to 248 °F; 391 to 393 K |
| Vapor pressure | 5.0 kPa (at 37.7 °C) |
Henry's law
constant (kH) |
2.7 nmol Pa−1 kg−1 |
| −97.99·10−6 cm3/mol | |
Refractive index (nD)
|
1.398–1.399 |
| Thermochemistry | |
Heat capacity (C)
|
250.20 J K−1 mol−1 |
Std molar
entropy (S⦵298) |
362.6 J K−1 mol−1 |
Std enthalpy of
formation (ΔfH⦵298) |
−253.6 – −251.4 kJ mol−1 |
Std enthalpy of
combustion (ΔcH⦵298) |
−5469.5 – −5466.9 kJ mol−1 |
| Hazards | |
| GHS labelling: | |
| |
| Danger | |
| H225, H304, H315, H336, H410 | |
| P210, P261, P273, P301+P310, P331 | |
| Flash point | 7.2 °C (45.0 °F; 280.3 K) |
| Explosive limits | 0.98–?% |
| Related compounds | |
Related alkanes
|
|
Related compounds
|
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
3-Methylheptane is a branched alkane isomeric to octane. Its structural formula is CH3CH2CH(CH3)CH2CH2CH2CH3. It has one stereocenter.
Its refractive index is 1.398 (20 °C, D).
References
References
- "3-METHYLHEPTANE - Compound Summary". PubChem Compound. USA: National Center for Biotechnology Information. 26 March 2005. Identification and Related Records. Retrieved 8 March 2012.





